C24H32N3O2+ — CID 155615738
N-(2,6-dimethylphenyl)-2-[1-(formamidomethyl)-2-phenylazepan-1-ium-1-yl]acetamide (PubChem CID 155615738) has the molecular formula C24H32N3O2+ and a molecular weight of 394.54 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-[1-(formamidomethyl)-2-phenylazepan-1-ium-1-yl]acetamide.
| Compound Name | N-(2,6-dimethylphenyl)-2-[1-(formamidomethyl)-2-phenylazepan-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 155615738 |
| Molecular Formula | C24H32N3O2+ |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-[1-(formamidomethyl)-2-phenylazepan-1-ium-1-yl]acetamide |
| SMILES | Cc1cccc(C)c1NC(=O)C[N+]1(CNC=O)CCCCCC1c1ccccc1 |
| InChI | InChI=1S/C24H31N3O2/c1-19-10-9-11-20(2)24(19)26-23(29)16-27(17-25-18-28)15-8-4-7-14-22(27)21-12-5-3-6-13-21/h3,5-6,9-13,18,22H,4,7-8,14-17H2,1-2H3,(H-,25,26,28,29)/p+1 |
| InChIKey | AABUOOCFIFTCIU-UHFFFAOYSA-O |
| XLogP | 4.08 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|