About dichloronickel;2-hydroxyethyl dihydrogen phosphate;trichloroyttrium
dichloronickel;2-hydroxyethyl dihydrogen phosphate;trichloroyttrium (PubChem CID 174854669) has the molecular formula C2H7Cl5NiO5PY
and a molecular weight of 466.91 g/mol. Its IUPAC name is dichloronickel;2-hydroxyethyl dihydrogen phosphate;trichloroyttrium.
Molecular Properties
| Compound Name | dichloronickel;2-hydroxyethyl dihydrogen phosphate;trichloroyttrium |
| PubChem CID | 174854669 |
| Molecular Formula | C2H7Cl5NiO5PY |
| Molecular Weight | 466.91 g/mol |
| Exact Mass | 463.69 |
| IUPAC Name | dichloronickel;2-hydroxyethyl dihydrogen phosphate;trichloroyttrium |
| SMILES | Cl[Ni]Cl.Cl[Y](Cl)Cl.O=P(O)(O)OCCO |
| InChI | InChI=1S/C2H7O5P.5ClH.Ni.Y/c3-1-2-7-8(4,5)6;;;;;;;/h3H,1-2H2,(H2,4,5,6);5*1H;;/q;;;;;;+2;+3/p-5 |
| InChIKey | PMYOUMCWAJGUBX-UHFFFAOYSA-I |
| XLogP | 2.53 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 466.91 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dichloronickel;2-hydroxyethyl dihydrogen phosphate;trichloroyttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloronickel;2-hydroxyethyl dihydrogen phosphate;trichloroyttrium?
The IUPAC name of dichloronickel;2-hydroxyethyl dihydrogen phosphate;trichloroyttrium (CID 174854669) is dichloronickel;2-hydroxyethyl dihydrogen phosphate;trichloroyttrium.
What is the SMILES notation for dichloronickel;2-hydroxyethyl dihydrogen phosphate;trichloroyttrium?
The canonical SMILES for dichloronickel;2-hydroxyethyl dihydrogen phosphate;trichloroyttrium is Cl[Ni]Cl.Cl[Y](Cl)Cl.O=P(O)(O)OCCO.
What is the InChIKey of dichloronickel;2-hydroxyethyl dihydrogen phosphate;trichloroyttrium?
The InChIKey is PMYOUMCWAJGUBX-UHFFFAOYSA-I. The full InChI is InChI=1S/C2H7O5P.5ClH.Ni.Y/c3-1-2-7-8(4,5)6;;;;;;;/h3H,1-2H2,(H2,4,5,6);5*1H;;/q;;;;;;+2;+3/p-5.
What are the key properties of dichloronickel;2-hydroxyethyl dihydrogen phosphate;trichloroyttrium?
dichloronickel;2-hydroxyethyl dihydrogen phosphate;trichloroyttrium has a molecular weight of 466.91 g/mol, XLogP of 2.53, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dichloronickel;2-hydroxyethyl dihydrogen phosphate;trichloroyttrium is sourced from PubChem (CID 174854669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).