C10H14N2O5S — CID 174856708
2-amino-5-(2-amino-2-sulfinooxypropyl)benzoic acid (PubChem CID 174856708) has the molecular formula C10H14N2O5S and a molecular weight of 274.30 g/mol. Its IUPAC name is 2-amino-5-(2-amino-2-sulfinooxypropyl)benzoic acid.
| Compound Name | 2-amino-5-(2-amino-2-sulfinooxypropyl)benzoic acid |
|---|---|
| PubChem CID | 174856708 |
| Molecular Formula | C10H14N2O5S |
| Molecular Weight | 274.30 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 2-amino-5-(2-amino-2-sulfinooxypropyl)benzoic acid |
| SMILES | CC(N)(Cc1ccc(N)c(C(=O)O)c1)OS(=O)O |
| InChI | InChI=1S/C10H14N2O5S/c1-10(12,17-18(15)16)5-6-2-3-8(11)7(4-6)9(13)14/h2-4H,5,11-12H2,1H3,(H,13,14)(H,15,16) |
| InChIKey | NJIWZMTZFWXQTB-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 135.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.30 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|