C8H6FN3S — CID 174857402
5-(3-fluorophenyl)sulfanyl-1H-1,2,4-triazole (PubChem CID 174857402) has the molecular formula C8H6FN3S and a molecular weight of 195.22 g/mol. Its IUPAC name is 5-(3-fluorophenyl)sulfanyl-1H-1,2,4-triazole.
| Compound Name | 5-(3-fluorophenyl)sulfanyl-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 174857402 |
| Molecular Formula | C8H6FN3S |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.03 |
| IUPAC Name | 5-(3-fluorophenyl)sulfanyl-1H-1,2,4-triazole |
| SMILES | Fc1cccc(Sc2ncn[nH]2)c1 |
| InChI | InChI=1S/C8H6FN3S/c9-6-2-1-3-7(4-6)13-8-10-5-11-12-8/h1-5H,(H,10,11,12) |
| InChIKey | MMKSGKWXSBEXAB-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |