C8H7N3S — CID 3642649
5-phenylsulfanyl-1H-1,2,4-triazole (PubChem CID 3642649) has the molecular formula C8H7N3S and a molecular weight of 177.23 g/mol. Its IUPAC name is 5-phenylsulfanyl-1H-1,2,4-triazole.
| Compound Name | 5-phenylsulfanyl-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 3642649 |
| Molecular Formula | C8H7N3S |
| Molecular Weight | 177.23 g/mol |
| Exact Mass | 177.04 |
| IUPAC Name | 5-phenylsulfanyl-1H-1,2,4-triazole |
| SMILES | c1ccc(Sc2ncn[nH]2)cc1 |
| InChI | InChI=1S/C8H7N3S/c1-2-4-7(5-3-1)12-8-9-6-10-11-8/h1-6H,(H,9,10,11) |
| InChIKey | QWYURAKQRYZRSB-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.23 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |