C18H27N5O4 — CID 174859503
(2R,5S)-5-hydroxy-N-[1-(phenylmethoxycarbamoyl)piperidin-4-yl]piperazine-2-carboxamide (PubChem CID 174859503) has the molecular formula C18H27N5O4 and a molecular weight of 377.45 g/mol. Its IUPAC name is (2R,5S)-5-hydroxy-N-[1-(phenylmethoxycarbamoyl)piperidin-4-yl]piperazine-2-carboxamide.
| Compound Name | (2R,5S)-5-hydroxy-N-[1-(phenylmethoxycarbamoyl)piperidin-4-yl]piperazine-2-carboxamide |
|---|---|
| PubChem CID | 174859503 |
| Molecular Formula | C18H27N5O4 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | (2R,5S)-5-hydroxy-N-[1-(phenylmethoxycarbamoyl)piperidin-4-yl]piperazine-2-carboxamide |
| SMILES | O=C(NC1CCN(C(=O)NOCc2ccccc2)CC1)[C@H]1CN[C@@H](O)CN1 |
| InChI | InChI=1S/C18H27N5O4/c24-16-11-19-15(10-20-16)17(25)21-14-6-8-23(9-7-14)18(26)22-27-12-13-4-2-1-3-5-13/h1-5,14-16,19-20,24H,6-12H2,(H,21,25)(H,22,26)/t15-,16+/m1/s1 |
| InChIKey | AKLTXSIMNYVBAD-CVEARBPZSA-N |
| XLogP | -0.71 |
| TPSA | 114.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|