C25H50O2 — CID 174861049
1-hydroperoxy-1-propyl-4,4-bis(2,4,4-trimethylpentan-2-yl)cyclohexane (PubChem CID 174861049) has the molecular formula C25H50O2 and a molecular weight of 382.67 g/mol. Its IUPAC name is 1-hydroperoxy-1-propyl-4,4-bis(2,4,4-trimethylpentan-2-yl)cyclohexane.
| Compound Name | 1-hydroperoxy-1-propyl-4,4-bis(2,4,4-trimethylpentan-2-yl)cyclohexane |
|---|---|
| PubChem CID | 174861049 |
| Molecular Formula | C25H50O2 |
| Molecular Weight | 382.67 g/mol |
| Exact Mass | 382.38 |
| IUPAC Name | 1-hydroperoxy-1-propyl-4,4-bis(2,4,4-trimethylpentan-2-yl)cyclohexane |
| SMILES | CCCC1(OO)CCC(C(C)(C)CC(C)(C)C)(C(C)(C)CC(C)(C)C)CC1 |
| InChI | InChI=1S/C25H50O2/c1-12-13-24(27-26)14-16-25(17-15-24,22(8,9)18-20(2,3)4)23(10,11)19-21(5,6)7/h26H,12-19H2,1-11H3 |
| InChIKey | STFKZPNKUDULOL-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.67 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|