C48H94O4 — CID 174939140
1-hydroperoxy-1-[1-[1-hydroperoxy-4,4-bis(2,4,4-trimethylpentan-2-yl)cyclohexyl]butyl]-4,4-bis(2,4,4-trimethylpentan-2-yl)cyclohexane (PubChem CID 174939140) has the molecular formula C48H94O4 and a molecular weight of 735.28 g/mol. Its IUPAC name is 1-hydroperoxy-1-[1-[1-hydroperoxy-4,4-bis(2,4,4-trimethylpentan-2-yl)cyclohexyl]butyl]-4,4-bis(2,4,4-trimethylpentan-2-yl)cyclohexane.
| Compound Name | 1-hydroperoxy-1-[1-[1-hydroperoxy-4,4-bis(2,4,4-trimethylpentan-2-yl)cyclohexyl]butyl]-4,4-bis(2,4,4-trimethylpentan-2-yl)cyclohexane |
|---|---|
| PubChem CID | 174939140 |
| Molecular Formula | C48H94O4 |
| Molecular Weight | 735.28 g/mol |
| Exact Mass | 734.72 |
| IUPAC Name | 1-hydroperoxy-1-[1-[1-hydroperoxy-4,4-bis(2,4,4-trimethylpentan-2-yl)cyclohexyl]butyl]-4,4-bis(2,4,4-trimethylpentan-2-yl)cyclohexane |
| SMILES | CCCC(C1(OO)CCC(C(C)(C)CC(C)(C)C)(C(C)(C)CC(C)(C)C)CC1)C1(OO)CCC(C(C)(C)CC(C)(C)C)(C(C)(C)CC(C)(C)C)CC1 |
| InChI | InChI=1S/C48H94O4/c1-22-23-36(45(51-49)24-28-47(29-25-45,41(14,15)32-37(2,3)4)42(16,17)33-38(5,6)7)46(52-50)26-30-48(31-27-46,43(18,19)34-39(8,9)10)44(20,21)35-40(11,12)13/h36,49-50H,22-35H2,1-21H3 |
| InChIKey | AKTDLNWQPPDKAB-UHFFFAOYSA-N |
| XLogP | 15.83 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.28 |
| LogP ≤ 5 | 15.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|