C25H50O2 — CID 172745778
4-propylperoxy-1,1-bis(2,4,4-trimethylpentan-2-yl)cyclohexane (PubChem CID 172745778) has the molecular formula C25H50O2 and a molecular weight of 382.67 g/mol. Its IUPAC name is 4-propylperoxy-1,1-bis(2,4,4-trimethylpentan-2-yl)cyclohexane.
| Compound Name | 4-propylperoxy-1,1-bis(2,4,4-trimethylpentan-2-yl)cyclohexane |
|---|---|
| PubChem CID | 172745778 |
| Molecular Formula | C25H50O2 |
| Molecular Weight | 382.67 g/mol |
| Exact Mass | 382.38 |
| IUPAC Name | 4-propylperoxy-1,1-bis(2,4,4-trimethylpentan-2-yl)cyclohexane |
| SMILES | CCCOOC1CCC(C(C)(C)CC(C)(C)C)(C(C)(C)CC(C)(C)C)CC1 |
| InChI | InChI=1S/C25H50O2/c1-12-17-26-27-20-13-15-25(16-14-20,23(8,9)18-21(2,3)4)24(10,11)19-22(5,6)7/h20H,12-19H2,1-11H3 |
| InChIKey | JRXRLWGEAROZFX-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.67 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|