C18H36O2 — CID 151316353
1,1-ditert-butyl-4-tert-butylperoxycyclohexane (PubChem CID 151316353) has the molecular formula C18H36O2 and a molecular weight of 284.48 g/mol. Its IUPAC name is 1,1-ditert-butyl-4-tert-butylperoxycyclohexane.
| Compound Name | 1,1-ditert-butyl-4-tert-butylperoxycyclohexane |
|---|---|
| PubChem CID | 151316353 |
| Molecular Formula | C18H36O2 |
| Molecular Weight | 284.48 g/mol |
| Exact Mass | 284.27 |
| IUPAC Name | 1,1-ditert-butyl-4-tert-butylperoxycyclohexane |
| SMILES | CC(C)(C)OOC1CCC(C(C)(C)C)(C(C)(C)C)CC1 |
| InChI | InChI=1S/C18H36O2/c1-15(2,3)18(16(4,5)6)12-10-14(11-13-18)19-20-17(7,8)9/h14H,10-13H2,1-9H3 |
| InChIKey | OFMSNKFKIOVZGW-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.48 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|