C28H54O2 — CID 141008223
1,1-ditert-butyl-4-(4,4-ditert-butylcyclohexyl)peroxycyclohexane (PubChem CID 141008223) has the molecular formula C28H54O2 and a molecular weight of 422.74 g/mol. Its IUPAC name is 1,1-ditert-butyl-4-(4,4-ditert-butylcyclohexyl)peroxycyclohexane.
| Compound Name | 1,1-ditert-butyl-4-(4,4-ditert-butylcyclohexyl)peroxycyclohexane |
|---|---|
| PubChem CID | 141008223 |
| Molecular Formula | C28H54O2 |
| Molecular Weight | 422.74 g/mol |
| Exact Mass | 422.41 |
| IUPAC Name | 1,1-ditert-butyl-4-(4,4-ditert-butylcyclohexyl)peroxycyclohexane |
| SMILES | CC(C)(C)C1(C(C)(C)C)CCC(OOC2CCC(C(C)(C)C)(C(C)(C)C)CC2)CC1 |
| InChI | InChI=1S/C28H54O2/c1-23(2,3)27(24(4,5)6)17-13-21(14-18-27)29-30-22-15-19-28(20-16-22,25(7,8)9)26(10,11)12/h21-22H,13-20H2,1-12H3 |
| InChIKey | VXTYNAYYDYWUSP-UHFFFAOYSA-N |
| XLogP | 8.98 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.74 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|