C13H26S — CID 22953096
4,4-ditert-butylthiane (PubChem CID 22953096) has the molecular formula C13H26S and a molecular weight of 214.42 g/mol. Its IUPAC name is 4,4-ditert-butylthiane.
| Compound Name | 4,4-ditert-butylthiane |
|---|---|
| PubChem CID | 22953096 |
| Molecular Formula | C13H26S |
| Molecular Weight | 214.42 g/mol |
| Exact Mass | 214.18 |
| IUPAC Name | 4,4-ditert-butylthiane |
| SMILES | CC(C)(C)C1(C(C)(C)C)CCSCC1 |
| InChI | InChI=1S/C13H26S/c1-11(2,3)13(12(4,5)6)7-9-14-10-8-13/h7-10H2,1-6H3 |
| InChIKey | BTHRZIQBJAQTMN-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.42 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |