C14H29P — CID 174901635
(4,4-ditert-butylcyclohexyl)phosphane (PubChem CID 174901635) has the molecular formula C14H29P and a molecular weight of 228.36 g/mol. Its IUPAC name is (4,4-ditert-butylcyclohexyl)phosphane.
| Compound Name | (4,4-ditert-butylcyclohexyl)phosphane |
|---|---|
| PubChem CID | 174901635 |
| Molecular Formula | C14H29P |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.20 |
| IUPAC Name | (4,4-ditert-butylcyclohexyl)phosphane |
| SMILES | CC(C)(C)C1(C(C)(C)C)CCC(P)CC1 |
| InChI | InChI=1S/C14H29P/c1-12(2,3)14(13(4,5)6)9-7-11(15)8-10-14/h11H,7-10,15H2,1-6H3 |
| InChIKey | UPPYODMPABSRID-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|