C21H42O6 — CID 172803464
2,3,5-tris(tert-butylperoxy)-1,1,5-trimethylcyclohexane (PubChem CID 172803464) has the molecular formula C21H42O6 and a molecular weight of 390.56 g/mol. Its IUPAC name is 2,3,5-tris(tert-butylperoxy)-1,1,5-trimethylcyclohexane.
| Compound Name | 2,3,5-tris(tert-butylperoxy)-1,1,5-trimethylcyclohexane |
|---|---|
| PubChem CID | 172803464 |
| Molecular Formula | C21H42O6 |
| Molecular Weight | 390.56 g/mol |
| Exact Mass | 390.30 |
| IUPAC Name | 2,3,5-tris(tert-butylperoxy)-1,1,5-trimethylcyclohexane |
| SMILES | CC(C)(C)OOC1CC(C)(OOC(C)(C)C)CC(C)(C)C1OOC(C)(C)C |
| InChI | InChI=1S/C21H42O6/c1-17(2,3)24-22-15-13-21(12,27-26-19(7,8)9)14-20(10,11)16(15)23-25-18(4,5)6/h15-16H,13-14H2,1-12H3 |
| InChIKey | REKOPNMFWMCQDF-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.56 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|