About but-2-ene;1-ethoxyethyl 2-methylidenebutaneperoxoate
but-2-ene;1-ethoxyethyl 2-methylidenebutaneperoxoate (PubChem CID 174862955) has the molecular formula C13H24O4
and a molecular weight of 244.33 g/mol. Its IUPAC name is but-2-ene;1-ethoxyethyl 2-methylidenebutaneperoxoate.
Molecular Properties
| Compound Name | but-2-ene;1-ethoxyethyl 2-methylidenebutaneperoxoate |
| PubChem CID | 174862955 |
| Molecular Formula | C13H24O4 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | but-2-ene;1-ethoxyethyl 2-methylidenebutaneperoxoate |
| SMILES | C=C(CC)C(=O)OOC(C)OCC.CC=CC |
| InChI | InChI=1S/C9H16O4.C4H8/c1-5-7(3)9(10)13-12-8(4)11-6-2;1-3-4-2/h8H,3,5-6H2,1-2,4H3;3-4H,1-2H3 |
| InChIKey | FAWWJTMOIFTCCW-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze but-2-ene;1-ethoxyethyl 2-methylidenebutaneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-2-ene;1-ethoxyethyl 2-methylidenebutaneperoxoate?
The IUPAC name of but-2-ene;1-ethoxyethyl 2-methylidenebutaneperoxoate (CID 174862955) is but-2-ene;1-ethoxyethyl 2-methylidenebutaneperoxoate.
What is the SMILES notation for but-2-ene;1-ethoxyethyl 2-methylidenebutaneperoxoate?
The canonical SMILES for but-2-ene;1-ethoxyethyl 2-methylidenebutaneperoxoate is C=C(CC)C(=O)OOC(C)OCC.CC=CC.
What is the InChIKey of but-2-ene;1-ethoxyethyl 2-methylidenebutaneperoxoate?
The InChIKey is FAWWJTMOIFTCCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O4.C4H8/c1-5-7(3)9(10)13-12-8(4)11-6-2;1-3-4-2/h8H,3,5-6H2,1-2,4H3;3-4H,1-2H3.
What are the key properties of but-2-ene;1-ethoxyethyl 2-methylidenebutaneperoxoate?
but-2-ene;1-ethoxyethyl 2-methylidenebutaneperoxoate has a molecular weight of 244.33 g/mol, XLogP of 3.39, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for but-2-ene;1-ethoxyethyl 2-methylidenebutaneperoxoate is sourced from PubChem (CID 174862955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).