C20H17ClF2N2O4 — CID 174864993
[[4-[(3,4-difluorobenzoyl)amino]-3-oxopiperidin-1-yl]-phenylmethyl] carbonochloridate (PubChem CID 174864993) has the molecular formula C20H17ClF2N2O4 and a molecular weight of 422.82 g/mol. Its IUPAC name is [[4-[(3,4-difluorobenzoyl)amino]-3-oxopiperidin-1-yl]-phenylmethyl] carbonochloridate.
| Compound Name | [[4-[(3,4-difluorobenzoyl)amino]-3-oxopiperidin-1-yl]-phenylmethyl] carbonochloridate |
|---|---|
| PubChem CID | 174864993 |
| Molecular Formula | C20H17ClF2N2O4 |
| Molecular Weight | 422.82 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | [[4-[(3,4-difluorobenzoyl)amino]-3-oxopiperidin-1-yl]-phenylmethyl] carbonochloridate |
| SMILES | O=C(Cl)OC(c1ccccc1)N1CCC(NC(=O)c2ccc(F)c(F)c2)C(=O)C1 |
| InChI | InChI=1S/C20H17ClF2N2O4/c21-20(28)29-19(12-4-2-1-3-5-12)25-9-8-16(17(26)11-25)24-18(27)13-6-7-14(22)15(23)10-13/h1-7,10,16,19H,8-9,11H2,(H,24,27) |
| InChIKey | YICIZLDEBMCGOM-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.82 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|