C6H14Cl2NO+ — CID 174868061
(1,1-dichloro-2-hydroxypropyl)-trimethylazanium (PubChem CID 174868061) has the molecular formula C6H14Cl2NO+ and a molecular weight of 187.09 g/mol. Its IUPAC name is (1,1-dichloro-2-hydroxypropyl)-trimethylazanium.
| Compound Name | (1,1-dichloro-2-hydroxypropyl)-trimethylazanium |
|---|---|
| PubChem CID | 174868061 |
| Molecular Formula | C6H14Cl2NO+ |
| Molecular Weight | 187.09 g/mol |
| Exact Mass | 186.04 |
| IUPAC Name | (1,1-dichloro-2-hydroxypropyl)-trimethylazanium |
| SMILES | CC(O)C(Cl)(Cl)[N+](C)(C)C |
| InChI | InChI=1S/C6H14Cl2NO/c1-5(10)6(7,8)9(2,3)4/h5,10H,1-4H3/q+1 |
| InChIKey | ZMHMSAVUNYIDMX-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.09 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|