About azanium;titanium(2+);borate
azanium;titanium(2+);borate (PubChem CID 174869145) has the molecular formula H4BNO3Ti
and a molecular weight of 124.71 g/mol. Its IUPAC name is azanium;titanium(2+);borate.
Molecular Properties
| Compound Name | azanium;titanium(2+);borate |
| PubChem CID | 174869145 |
| Molecular Formula | H4BNO3Ti |
| Molecular Weight | 124.71 g/mol |
| Exact Mass | 124.98 |
| IUPAC Name | azanium;titanium(2+);borate |
| SMILES | [NH4+].[O-]B([O-])[O-].[Ti+2] |
| InChI | InChI=1S/BO3.H3N.Ti/c2-1(3)4;;/h;1H3;/q-3;;+2/p+1 |
| InChIKey | MYUSJGKVNRISHU-UHFFFAOYSA-O |
| XLogP | -3.57 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.71 |
| LogP ≤ 5 | -3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze azanium;titanium(2+);borate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium;titanium(2+);borate?
The IUPAC name of azanium;titanium(2+);borate (CID 174869145) is azanium;titanium(2+);borate.
What is the SMILES notation for azanium;titanium(2+);borate?
The canonical SMILES for azanium;titanium(2+);borate is [NH4+].[O-]B([O-])[O-].[Ti+2].
What is the InChIKey of azanium;titanium(2+);borate?
The InChIKey is MYUSJGKVNRISHU-UHFFFAOYSA-O. The full InChI is InChI=1S/BO3.H3N.Ti/c2-1(3)4;;/h;1H3;/q-3;;+2/p+1.
What are the key properties of azanium;titanium(2+);borate?
azanium;titanium(2+);borate has a molecular weight of 124.71 g/mol, XLogP of -3.57, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azanium;titanium(2+);borate is sourced from PubChem (CID 174869145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).