C14H24LiN — CID 174875371
lithium;N,N-dimethyl-2,3-dipropylaniline;hydride (PubChem CID 174875371) has the molecular formula C14H24LiN and a molecular weight of 213.29 g/mol. Its IUPAC name is lithium;N,N-dimethyl-2,3-dipropylaniline;hydride.
| Compound Name | lithium;N,N-dimethyl-2,3-dipropylaniline;hydride |
|---|---|
| PubChem CID | 174875371 |
| Molecular Formula | C14H24LiN |
| Molecular Weight | 213.29 g/mol |
| Exact Mass | 213.21 |
| IUPAC Name | lithium;N,N-dimethyl-2,3-dipropylaniline;hydride |
| SMILES | CCCc1cccc(N(C)C)c1CCC.[H-].[Li+] |
| InChI | InChI=1S/C14H23N.Li.H/c1-5-8-12-10-7-11-14(15(3)4)13(12)9-6-2;;/h7,10-11H,5-6,8-9H2,1-4H3;;/q;+1;-1 |
| InChIKey | YELQRSFGVFHRGW-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.29 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |