About hydron;phosphorososilane;tetrabutylazanium
hydron;phosphorososilane;tetrabutylazanium (PubChem CID 174875707) has the molecular formula C16H40NOPSi+2
and a molecular weight of 321.56 g/mol. Its IUPAC name is hydron;phosphorososilane;tetrabutylazanium.
Molecular Properties
| Compound Name | hydron;phosphorososilane;tetrabutylazanium |
| PubChem CID | 174875707 |
| Molecular Formula | C16H40NOPSi+2 |
| Molecular Weight | 321.56 g/mol |
| Exact Mass | 321.26 |
| IUPAC Name | hydron;phosphorososilane;tetrabutylazanium |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.O=P[SiH3].[H+] |
| InChI | InChI=1S/C16H36N.H3OPSi/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-2-3/h5-16H2,1-4H3;3H3/q+1;/p+1 |
| InChIKey | NYQQYGUERWOIAK-UHFFFAOYSA-O |
| XLogP | 4.67 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.56 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze hydron;phosphorososilane;tetrabutylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydron;phosphorososilane;tetrabutylazanium?
The IUPAC name of hydron;phosphorososilane;tetrabutylazanium (CID 174875707) is hydron;phosphorososilane;tetrabutylazanium.
What is the SMILES notation for hydron;phosphorososilane;tetrabutylazanium?
The canonical SMILES for hydron;phosphorososilane;tetrabutylazanium is CCCC[N+](CCCC)(CCCC)CCCC.O=P[SiH3].[H+].
What is the InChIKey of hydron;phosphorososilane;tetrabutylazanium?
The InChIKey is NYQQYGUERWOIAK-UHFFFAOYSA-O. The full InChI is InChI=1S/C16H36N.H3OPSi/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-2-3/h5-16H2,1-4H3;3H3/q+1;/p+1.
What are the key properties of hydron;phosphorososilane;tetrabutylazanium?
hydron;phosphorososilane;tetrabutylazanium has a molecular weight of 321.56 g/mol, XLogP of 4.67, 12 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hydron;phosphorososilane;tetrabutylazanium is sourced from PubChem (CID 174875707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).