C21H17ClFN3O5S — CID 17487643
4-[(4-chloro-2-fluorophenyl)sulfonylamino]-N-[2-(2-hydroxyanilino)-2-oxoethyl]benzamide (PubChem CID 17487643) has the molecular formula C21H17ClFN3O5S and a molecular weight of 477.90 g/mol. Its IUPAC name is 4-[(4-chloro-2-fluorophenyl)sulfonylamino]-N-[2-(2-hydroxyanilino)-2-oxoethyl]benzamide.
| Compound Name | 4-[(4-chloro-2-fluorophenyl)sulfonylamino]-N-[2-(2-hydroxyanilino)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 17487643 |
| Molecular Formula | C21H17ClFN3O5S |
| Molecular Weight | 477.90 g/mol |
| Exact Mass | 477.06 |
| IUPAC Name | 4-[(4-chloro-2-fluorophenyl)sulfonylamino]-N-[2-(2-hydroxyanilino)-2-oxoethyl]benzamide |
| SMILES | O=C(CNC(=O)c1ccc(NS(=O)(=O)c2ccc(Cl)cc2F)cc1)Nc1ccccc1O |
| InChI | InChI=1S/C21H17ClFN3O5S/c22-14-7-10-19(16(23)11-14)32(30,31)26-15-8-5-13(6-9-15)21(29)24-12-20(28)25-17-3-1-2-4-18(17)27/h1-11,26-27H,12H2,(H,24,29)(H,25,28) |
| InChIKey | FQWOBDYPJBSNGE-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.90 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|