C5H6F8LiO5P — CID 174877964
lithium;1,1,2,2,3,3,4,4-octafluoropentan-1-olate;phosphoric acid (PubChem CID 174877964) has the molecular formula C5H6F8LiO5P and a molecular weight of 336.00 g/mol. Its IUPAC name is lithium;1,1,2,2,3,3,4,4-octafluoropentan-1-olate;phosphoric acid.
| Compound Name | lithium;1,1,2,2,3,3,4,4-octafluoropentan-1-olate;phosphoric acid |
|---|---|
| PubChem CID | 174877964 |
| Molecular Formula | C5H6F8LiO5P |
| Molecular Weight | 336.00 g/mol |
| Exact Mass | 336.00 |
| IUPAC Name | lithium;1,1,2,2,3,3,4,4-octafluoropentan-1-olate;phosphoric acid |
| SMILES | CC(F)(F)C(F)(F)C(F)(F)C([O-])(F)F.O=P(O)(O)O.[Li+] |
| InChI | InChI=1S/C5H3F8O.Li.H3O4P/c1-2(6,7)3(8,9)4(10,11)5(12,13)14;;1-5(2,3)4/h1H3;;(H3,1,2,3,4)/q-1;+1; |
| InChIKey | HMXJIMFIILNQPP-UHFFFAOYSA-N |
| XLogP | -2.06 |
| TPSA | 100.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.00 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|