C4F8Na2O2 — CID 170558309
disodium;1,1,2,2,3,3,4,4-octafluorobutane-1,4-diolate (PubChem CID 170558309) has the molecular formula C4F8Na2O2 and a molecular weight of 278.01 g/mol. Its IUPAC name is disodium;1,1,2,2,3,3,4,4-octafluorobutane-1,4-diolate.
| Compound Name | disodium;1,1,2,2,3,3,4,4-octafluorobutane-1,4-diolate |
|---|---|
| PubChem CID | 170558309 |
| Molecular Formula | C4F8Na2O2 |
| Molecular Weight | 278.01 g/mol |
| Exact Mass | 277.96 |
| IUPAC Name | disodium;1,1,2,2,3,3,4,4-octafluorobutane-1,4-diolate |
| SMILES | [Na+].[Na+].[O-]C(F)(F)C(F)(F)C(F)(F)C([O-])(F)F |
| InChI | InChI=1S/C4F8O2.2Na/c5-1(6,3(9,10)13)2(7,8)4(11,12)14;;/q-2;2*+1 |
| InChIKey | NYFZOFJFKTUBAR-UHFFFAOYSA-N |
| XLogP | -5.83 |
| TPSA | 46.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.01 |
| LogP ≤ 5 | -5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|