C6F13KO — CID 156775939
potassium 1,1,3,3,4,4,4-heptafluoro-2,2-bis(trifluoromethyl)butan-1-olate (PubChem CID 156775939) has the molecular formula C6F13KO and a molecular weight of 374.14 g/mol. Its IUPAC name is potassium 1,1,3,3,4,4,4-heptafluoro-2,2-bis(trifluoromethyl)butan-1-olate.
| Compound Name | potassium 1,1,3,3,4,4,4-heptafluoro-2,2-bis(trifluoromethyl)butan-1-olate |
|---|---|
| PubChem CID | 156775939 |
| Molecular Formula | C6F13KO |
| Molecular Weight | 374.14 g/mol |
| Exact Mass | 373.94 |
| IUPAC Name | potassium 1,1,3,3,4,4,4-heptafluoro-2,2-bis(trifluoromethyl)butan-1-olate |
| SMILES | [K+].[O-]C(F)(F)C(C(F)(F)F)(C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6F13O.K/c7-2(8,5(15,16)17)1(3(9,10)11,4(12,13)14)6(18,19)20;/q-1;+1 |
| InChIKey | VMPVDNVJWIXWSQ-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.14 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|