About magnesium;3-(6-but-2-enoyloxyhexoxycarbonyl)but-3-enoic acid;hydride
magnesium;3-(6-but-2-enoyloxyhexoxycarbonyl)but-3-enoic acid;hydride (PubChem CID 174879892) has the molecular formula C15H24MgO6
and a molecular weight of 324.66 g/mol. Its IUPAC name is magnesium;3-(6-but-2-enoyloxyhexoxycarbonyl)but-3-enoic acid;hydride.
Molecular Properties
| Compound Name | magnesium;3-(6-but-2-enoyloxyhexoxycarbonyl)but-3-enoic acid;hydride |
| PubChem CID | 174879892 |
| Molecular Formula | C15H24MgO6 |
| Molecular Weight | 324.66 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | magnesium;3-(6-but-2-enoyloxyhexoxycarbonyl)but-3-enoic acid;hydride |
| SMILES | C=C(CC(=O)O)C(=O)OCCCCCCOC(=O)C=CC.[H-].[H-].[Mg+2] |
| InChI | InChI=1S/C15H22O6.Mg.2H/c1-3-8-14(18)20-9-6-4-5-7-10-21-15(19)12(2)11-13(16)17;;;/h3,8H,2,4-7,9-11H2,1H3,(H,16,17);;;/q;+2;2*-1 |
| InChIKey | APOIIPAJLPLDLM-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.66 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze magnesium;3-(6-but-2-enoyloxyhexoxycarbonyl)but-3-enoic acid;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;3-(6-but-2-enoyloxyhexoxycarbonyl)but-3-enoic acid;hydride?
The IUPAC name of magnesium;3-(6-but-2-enoyloxyhexoxycarbonyl)but-3-enoic acid;hydride (CID 174879892) is magnesium;3-(6-but-2-enoyloxyhexoxycarbonyl)but-3-enoic acid;hydride.
What is the SMILES notation for magnesium;3-(6-but-2-enoyloxyhexoxycarbonyl)but-3-enoic acid;hydride?
The canonical SMILES for magnesium;3-(6-but-2-enoyloxyhexoxycarbonyl)but-3-enoic acid;hydride is C=C(CC(=O)O)C(=O)OCCCCCCOC(=O)C=CC.[H-].[H-].[Mg+2].
What is the InChIKey of magnesium;3-(6-but-2-enoyloxyhexoxycarbonyl)but-3-enoic acid;hydride?
The InChIKey is APOIIPAJLPLDLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22O6.Mg.2H/c1-3-8-14(18)20-9-6-4-5-7-10-21-15(19)12(2)11-13(16)17;;;/h3,8H,2,4-7,9-11H2,1H3,(H,16,17);;;/q;+2;2*-1.
What are the key properties of magnesium;3-(6-but-2-enoyloxyhexoxycarbonyl)but-3-enoic acid;hydride?
magnesium;3-(6-but-2-enoyloxyhexoxycarbonyl)but-3-enoic acid;hydride has a molecular weight of 324.66 g/mol, XLogP of 2.08, 11 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;3-(6-but-2-enoyloxyhexoxycarbonyl)but-3-enoic acid;hydride is sourced from PubChem (CID 174879892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).