About benzonitrile;2-phenyl-1,3,5-triazine
benzonitrile;2-phenyl-1,3,5-triazine (PubChem CID 174883787) has the molecular formula C16H12N4
and a molecular weight of 260.30 g/mol. Its IUPAC name is benzonitrile;2-phenyl-1,3,5-triazine.
Molecular Properties
| Compound Name | benzonitrile;2-phenyl-1,3,5-triazine |
| PubChem CID | 174883787 |
| Molecular Formula | C16H12N4 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | benzonitrile;2-phenyl-1,3,5-triazine |
| SMILES | N#Cc1ccccc1.c1ccc(-c2ncncn2)cc1 |
| InChI | InChI=1S/C9H7N3.C7H5N/c1-2-4-8(5-3-1)9-11-6-10-7-12-9;8-6-7-4-2-1-3-5-7/h1-7H;1-5H |
| InChIKey | SSFXDZHGDKDXNI-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze benzonitrile;2-phenyl-1,3,5-triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzonitrile;2-phenyl-1,3,5-triazine?
The IUPAC name of benzonitrile;2-phenyl-1,3,5-triazine (CID 174883787) is benzonitrile;2-phenyl-1,3,5-triazine.
What is the SMILES notation for benzonitrile;2-phenyl-1,3,5-triazine?
The canonical SMILES for benzonitrile;2-phenyl-1,3,5-triazine is N#Cc1ccccc1.c1ccc(-c2ncncn2)cc1.
What is the InChIKey of benzonitrile;2-phenyl-1,3,5-triazine?
The InChIKey is SSFXDZHGDKDXNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N3.C7H5N/c1-2-4-8(5-3-1)9-11-6-10-7-12-9;8-6-7-4-2-1-3-5-7/h1-7H;1-5H.
What are the key properties of benzonitrile;2-phenyl-1,3,5-triazine?
benzonitrile;2-phenyl-1,3,5-triazine has a molecular weight of 260.30 g/mol, XLogP of 3.10, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzonitrile;2-phenyl-1,3,5-triazine is sourced from PubChem (CID 174883787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).