C29H18N5OP — CID 145345012
4-[(4-cyanophenyl)-[4-(4-phenyl-1,3,5-triazin-2-yl)phenyl]phosphoryl]benzonitrile (PubChem CID 145345012) has the molecular formula C29H18N5OP and a molecular weight of 483.47 g/mol. Its IUPAC name is 4-[(4-cyanophenyl)-[4-(4-phenyl-1,3,5-triazin-2-yl)phenyl]phosphoryl]benzonitrile.
| Compound Name | 4-[(4-cyanophenyl)-[4-(4-phenyl-1,3,5-triazin-2-yl)phenyl]phosphoryl]benzonitrile |
|---|---|
| PubChem CID | 145345012 |
| Molecular Formula | C29H18N5OP |
| Molecular Weight | 483.47 g/mol |
| Exact Mass | 483.12 |
| IUPAC Name | 4-[(4-cyanophenyl)-[4-(4-phenyl-1,3,5-triazin-2-yl)phenyl]phosphoryl]benzonitrile |
| SMILES | N#Cc1ccc(P(=O)(c2ccc(C#N)cc2)c2ccc(-c3ncnc(-c4ccccc4)n3)cc2)cc1 |
| InChI | InChI=1S/C29H18N5OP/c30-18-21-6-12-25(13-7-21)36(35,26-14-8-22(19-31)9-15-26)27-16-10-24(11-17-27)29-33-20-32-28(34-29)23-4-2-1-3-5-23/h1-17,20H |
| InChIKey | ASXRTAFPJIGOJV-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 103.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.47 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|