C30H20N6O — CID 140904944
2,4-diphenyl-6-[4-[4-(1,3,5-triazin-2-yl)phenoxy]phenyl]-1,3,5-triazine (PubChem CID 140904944) has the molecular formula C30H20N6O and a molecular weight of 480.53 g/mol. Its IUPAC name is 2,4-diphenyl-6-[4-[4-(1,3,5-triazin-2-yl)phenoxy]phenyl]-1,3,5-triazine.
| Compound Name | 2,4-diphenyl-6-[4-[4-(1,3,5-triazin-2-yl)phenoxy]phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 140904944 |
| Molecular Formula | C30H20N6O |
| Molecular Weight | 480.53 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | 2,4-diphenyl-6-[4-[4-(1,3,5-triazin-2-yl)phenoxy]phenyl]-1,3,5-triazine |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc(Oc4ccc(-c5ncncn5)cc4)cc3)n2)cc1 |
| InChI | InChI=1S/C30H20N6O/c1-3-7-21(8-4-1)28-34-29(22-9-5-2-6-10-22)36-30(35-28)24-13-17-26(18-14-24)37-25-15-11-23(12-16-25)27-32-19-31-20-33-27/h1-20H |
| InChIKey | VIJFHYWWVXPIKO-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 86.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.53 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |