C7H19NO5P+ — CID 174888571
5-aminoheptane-1,1-diol;dihydroxy(oxo)phosphanium (PubChem CID 174888571) has the molecular formula C7H19NO5P+ and a molecular weight of 228.20 g/mol. Its IUPAC name is 5-aminoheptane-1,1-diol;dihydroxy(oxo)phosphanium.
| Compound Name | 5-aminoheptane-1,1-diol;dihydroxy(oxo)phosphanium |
|---|---|
| PubChem CID | 174888571 |
| Molecular Formula | C7H19NO5P+ |
| Molecular Weight | 228.20 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 5-aminoheptane-1,1-diol;dihydroxy(oxo)phosphanium |
| SMILES | CCC(N)CCCC(O)O.O=[P+](O)O |
| InChI | InChI=1S/C7H17NO2.HO3P/c1-2-6(8)4-3-5-7(9)10;1-4(2)3/h6-7,9-10H,2-5,8H2,1H3;(H-,1,2,3)/p+1 |
| InChIKey | LBLSFVBYNBRMEG-UHFFFAOYSA-O |
| XLogP | -0.17 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.20 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|