C20H11BrN2S2 — CID 174889255
2-bromo-4,7-dithiophen-2-yl-1,10-phenanthroline (PubChem CID 174889255) has the molecular formula C20H11BrN2S2 and a molecular weight of 423.36 g/mol. Its IUPAC name is 2-bromo-4,7-dithiophen-2-yl-1,10-phenanthroline.
| Compound Name | 2-bromo-4,7-dithiophen-2-yl-1,10-phenanthroline |
|---|---|
| PubChem CID | 174889255 |
| Molecular Formula | C20H11BrN2S2 |
| Molecular Weight | 423.36 g/mol |
| Exact Mass | 421.95 |
| IUPAC Name | 2-bromo-4,7-dithiophen-2-yl-1,10-phenanthroline |
| SMILES | Brc1cc(-c2cccs2)c2ccc3c(-c4cccs4)ccnc3c2n1 |
| InChI | InChI=1S/C20H11BrN2S2/c21-18-11-15(17-4-2-10-25-17)14-6-5-13-12(16-3-1-9-24-16)7-8-22-19(13)20(14)23-18/h1-11H |
| InChIKey | SKIVJIOHQVJZDP-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.36 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|