C10H7FN2O4 — CID 174892254
2-(1-fluoro-7-nitro-2,3-dihydroindol-3-yl)-2-oxoacetaldehyde (PubChem CID 174892254) has the molecular formula C10H7FN2O4 and a molecular weight of 238.17 g/mol. Its IUPAC name is 2-(1-fluoro-7-nitro-2,3-dihydroindol-3-yl)-2-oxoacetaldehyde.
| Compound Name | 2-(1-fluoro-7-nitro-2,3-dihydroindol-3-yl)-2-oxoacetaldehyde |
|---|---|
| PubChem CID | 174892254 |
| Molecular Formula | C10H7FN2O4 |
| Molecular Weight | 238.17 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | 2-(1-fluoro-7-nitro-2,3-dihydroindol-3-yl)-2-oxoacetaldehyde |
| SMILES | O=CC(=O)C1CN(F)c2c1cccc2[N+](=O)[O-] |
| InChI | InChI=1S/C10H7FN2O4/c11-12-4-7(9(15)5-14)6-2-1-3-8(10(6)12)13(16)17/h1-3,5,7H,4H2 |
| InChIKey | CEBSPUSSUNCKRU-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.17 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|