C13H16N2O4 — CID 174723133
tert-butyl formate;5-nitro-7-azatricyclo[4.3.0.07,9]nona-1(6),2,4-triene (PubChem CID 174723133) has the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. Its IUPAC name is tert-butyl formate;5-nitro-7-azatricyclo[4.3.0.07,9]nona-1(6),2,4-triene.
| Compound Name | tert-butyl formate;5-nitro-7-azatricyclo[4.3.0.07,9]nona-1(6),2,4-triene |
|---|---|
| PubChem CID | 174723133 |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | tert-butyl formate;5-nitro-7-azatricyclo[4.3.0.07,9]nona-1(6),2,4-triene |
| SMILES | CC(C)(C)OC=O.O=[N+]([O-])c1cccc2c1N1CC21 |
| InChI | InChI=1S/C8H6N2O2.C5H10O2/c11-10(12)6-3-1-2-5-7-4-9(7)8(5)6;1-5(2,3)7-4-6/h1-3,7H,4H2;4H,1-3H3 |
| InChIKey | HOOYMCDPFVTQAH-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|