C21H22O2 — CID 174895063
methyl 2-(4-benzylphenyl)-3-methylhexa-2,5-dienoate (PubChem CID 174895063) has the molecular formula C21H22O2 and a molecular weight of 306.41 g/mol. Its IUPAC name is methyl 2-(4-benzylphenyl)-3-methylhexa-2,5-dienoate.
| Compound Name | methyl 2-(4-benzylphenyl)-3-methylhexa-2,5-dienoate |
|---|---|
| PubChem CID | 174895063 |
| Molecular Formula | C21H22O2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | methyl 2-(4-benzylphenyl)-3-methylhexa-2,5-dienoate |
| SMILES | C=CCC(C)=C(C(=O)OC)c1ccc(Cc2ccccc2)cc1 |
| InChI | InChI=1S/C21H22O2/c1-4-8-16(2)20(21(22)23-3)19-13-11-18(12-14-19)15-17-9-6-5-7-10-17/h4-7,9-14H,1,8,15H2,2-3H3 |
| InChIKey | VJTFKAAPVWAZCY-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|