About benzylbenzene;diphenylmethanone;prop-2-enyl formate
benzylbenzene;diphenylmethanone;prop-2-enyl formate (PubChem CID 174817716) has the molecular formula C30H28O3
and a molecular weight of 436.55 g/mol. Its IUPAC name is benzylbenzene;diphenylmethanone;prop-2-enyl formate.
Molecular Properties
| Compound Name | benzylbenzene;diphenylmethanone;prop-2-enyl formate |
| PubChem CID | 174817716 |
| Molecular Formula | C30H28O3 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | benzylbenzene;diphenylmethanone;prop-2-enyl formate |
| SMILES | C=CCOC=O.O=C(c1ccccc1)c1ccccc1.c1ccc(Cc2ccccc2)cc1 |
| InChI | InChI=1S/C13H10O.C13H12.C4H6O2/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;1-2-3-6-4-5/h1-10H;1-10H,11H2;2,4H,1,3H2 |
| InChIKey | KSRXKAOVTXWKLH-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze benzylbenzene;diphenylmethanone;prop-2-enyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzylbenzene;diphenylmethanone;prop-2-enyl formate?
The IUPAC name of benzylbenzene;diphenylmethanone;prop-2-enyl formate (CID 174817716) is benzylbenzene;diphenylmethanone;prop-2-enyl formate.
What is the SMILES notation for benzylbenzene;diphenylmethanone;prop-2-enyl formate?
The canonical SMILES for benzylbenzene;diphenylmethanone;prop-2-enyl formate is C=CCOC=O.O=C(c1ccccc1)c1ccccc1.c1ccc(Cc2ccccc2)cc1.
What is the InChIKey of benzylbenzene;diphenylmethanone;prop-2-enyl formate?
The InChIKey is KSRXKAOVTXWKLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O.C13H12.C4H6O2/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;1-2-3-6-4-5/h1-10H;1-10H,11H2;2,4H,1,3H2.
What are the key properties of benzylbenzene;diphenylmethanone;prop-2-enyl formate?
benzylbenzene;diphenylmethanone;prop-2-enyl formate has a molecular weight of 436.55 g/mol, XLogP of 6.54, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzylbenzene;diphenylmethanone;prop-2-enyl formate is sourced from PubChem (CID 174817716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).