C8H14N2O — CID 174895371
1-(aminomethyl)-4,6-dimethyl-2H-pyridin-2-ol (PubChem CID 174895371) has the molecular formula C8H14N2O and a molecular weight of 154.21 g/mol. Its IUPAC name is 1-(aminomethyl)-4,6-dimethyl-2H-pyridin-2-ol.
| Compound Name | 1-(aminomethyl)-4,6-dimethyl-2H-pyridin-2-ol |
|---|---|
| PubChem CID | 174895371 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | 1-(aminomethyl)-4,6-dimethyl-2H-pyridin-2-ol |
| SMILES | CC1=CC(O)N(CN)C(C)=C1 |
| InChI | InChI=1S/C8H14N2O/c1-6-3-7(2)10(5-9)8(11)4-6/h3-4,8,11H,5,9H2,1-2H3 |
| InChIKey | RNVDAWWBNHJMLK-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |