About 3-amino-5-methylcyclohexa-3,5-diene-1,2-diol
3-amino-5-methylcyclohexa-3,5-diene-1,2-diol (PubChem CID 162425810) has the molecular formula C7H11NO2
and a molecular weight of 141.17 g/mol. Its IUPAC name is 3-amino-5-methylcyclohexa-3,5-diene-1,2-diol.
Molecular Properties
| Compound Name | 3-amino-5-methylcyclohexa-3,5-diene-1,2-diol |
| PubChem CID | 162425810 |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | 3-amino-5-methylcyclohexa-3,5-diene-1,2-diol |
| SMILES | CC1=CC(O)C(O)C(N)=C1 |
| InChI | InChI=1S/C7H11NO2/c1-4-2-5(8)7(10)6(9)3-4/h2-3,6-7,9-10H,8H2,1H3 |
| InChIKey | GGVYLLOEQISHSO-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-amino-5-methylcyclohexa-3,5-diene-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-5-methylcyclohexa-3,5-diene-1,2-diol?
The IUPAC name of 3-amino-5-methylcyclohexa-3,5-diene-1,2-diol (CID 162425810) is 3-amino-5-methylcyclohexa-3,5-diene-1,2-diol.
What is the SMILES notation for 3-amino-5-methylcyclohexa-3,5-diene-1,2-diol?
The canonical SMILES for 3-amino-5-methylcyclohexa-3,5-diene-1,2-diol is CC1=CC(O)C(O)C(N)=C1.
What is the InChIKey of 3-amino-5-methylcyclohexa-3,5-diene-1,2-diol?
The InChIKey is GGVYLLOEQISHSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO2/c1-4-2-5(8)7(10)6(9)3-4/h2-3,6-7,9-10H,8H2,1H3.
What are the key properties of 3-amino-5-methylcyclohexa-3,5-diene-1,2-diol?
3-amino-5-methylcyclohexa-3,5-diene-1,2-diol has a molecular weight of 141.17 g/mol, XLogP of -0.49, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-5-methylcyclohexa-3,5-diene-1,2-diol is sourced from PubChem (CID 162425810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).