About 2,4-dimethyl-6-(methylamino)cyclohexa-2,4-dien-1-ol
2,4-dimethyl-6-(methylamino)cyclohexa-2,4-dien-1-ol (PubChem CID 163653794) has the molecular formula C9H15NO
and a molecular weight of 153.22 g/mol. Its IUPAC name is 2,4-dimethyl-6-(methylamino)cyclohexa-2,4-dien-1-ol.
Analyze 2,4-dimethyl-6-(methylamino)cyclohexa-2,4-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethyl-6-(methylamino)cyclohexa-2,4-dien-1-ol?
The IUPAC name of 2,4-dimethyl-6-(methylamino)cyclohexa-2,4-dien-1-ol (CID 163653794) is 2,4-dimethyl-6-(methylamino)cyclohexa-2,4-dien-1-ol.
What is the SMILES notation for 2,4-dimethyl-6-(methylamino)cyclohexa-2,4-dien-1-ol?
The canonical SMILES for 2,4-dimethyl-6-(methylamino)cyclohexa-2,4-dien-1-ol is CNC1C=C(C)C=C(C)C1O.
What is the InChIKey of 2,4-dimethyl-6-(methylamino)cyclohexa-2,4-dien-1-ol?
The InChIKey is IOLVEDSBGKQHQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO/c1-6-4-7(2)9(11)8(5-6)10-3/h4-5,8-11H,1-3H3.
What are the key properties of 2,4-dimethyl-6-(methylamino)cyclohexa-2,4-dien-1-ol?
2,4-dimethyl-6-(methylamino)cyclohexa-2,4-dien-1-ol has a molecular weight of 153.22 g/mol, XLogP of 0.84, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethyl-6-(methylamino)cyclohexa-2,4-dien-1-ol is sourced from PubChem (CID 163653794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).