C15H11BrIN3 — CID 174896057
1-bromo-3-iodobenzene;2-phenyl-1,3,5-triazine (PubChem CID 174896057) has the molecular formula C15H11BrIN3 and a molecular weight of 440.08 g/mol. Its IUPAC name is 1-bromo-3-iodobenzene;2-phenyl-1,3,5-triazine.
| Compound Name | 1-bromo-3-iodobenzene;2-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 174896057 |
| Molecular Formula | C15H11BrIN3 |
| Molecular Weight | 440.08 g/mol |
| Exact Mass | 438.92 |
| IUPAC Name | 1-bromo-3-iodobenzene;2-phenyl-1,3,5-triazine |
| SMILES | Brc1cccc(I)c1.c1ccc(-c2ncncn2)cc1 |
| InChI | InChI=1S/C9H7N3.C6H4BrI/c1-2-4-8(5-3-1)9-11-6-10-7-12-9;7-5-2-1-3-6(8)4-5/h1-7H;1-4H |
| InChIKey | WWVGVUCCTWEYJX-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.08 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|