C12H16N2O5S — CID 174899079
methyl 3-[(2-methylphenyl)sulfonylcarbamoylamino]propanoate (PubChem CID 174899079) has the molecular formula C12H16N2O5S and a molecular weight of 300.34 g/mol. Its IUPAC name is methyl 3-[(2-methylphenyl)sulfonylcarbamoylamino]propanoate.
| Compound Name | methyl 3-[(2-methylphenyl)sulfonylcarbamoylamino]propanoate |
|---|---|
| PubChem CID | 174899079 |
| Molecular Formula | C12H16N2O5S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | methyl 3-[(2-methylphenyl)sulfonylcarbamoylamino]propanoate |
| SMILES | COC(=O)CCNC(=O)NS(=O)(=O)c1ccccc1C |
| InChI | InChI=1S/C12H16N2O5S/c1-9-5-3-4-6-10(9)20(17,18)14-12(16)13-8-7-11(15)19-2/h3-6H,7-8H2,1-2H3,(H2,13,14,16) |
| InChIKey | WURKKQLWYGPIIJ-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |