About 2-iodoacetamide;2-iodoacetohydrazide;stilbene
2-iodoacetamide;2-iodoacetohydrazide;stilbene (PubChem CID 174899327) has the molecular formula C18H21I2N3O2
and a molecular weight of 565.19 g/mol. Its IUPAC name is 2-iodoacetamide;2-iodoacetohydrazide;stilbene.
Molecular Properties
| Compound Name | 2-iodoacetamide;2-iodoacetohydrazide;stilbene |
| PubChem CID | 174899327 |
| Molecular Formula | C18H21I2N3O2 |
| Molecular Weight | 565.19 g/mol |
| Exact Mass | 564.97 |
| IUPAC Name | 2-iodoacetamide;2-iodoacetohydrazide;stilbene |
| SMILES | C(=Cc1ccccc1)c1ccccc1.NC(=O)CI.NNC(=O)CI |
| InChI | InChI=1S/C14H12.C2H5IN2O.C2H4INO/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;3-1-2(6)5-4;3-1-2(4)5/h1-12H;1,4H2,(H,5,6);1H2,(H2,4,5) |
| InChIKey | PQRACGLCMXXOSV-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 565.19 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-iodoacetamide;2-iodoacetohydrazide;stilbene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-iodoacetamide;2-iodoacetohydrazide;stilbene?
The IUPAC name of 2-iodoacetamide;2-iodoacetohydrazide;stilbene (CID 174899327) is 2-iodoacetamide;2-iodoacetohydrazide;stilbene.
What is the SMILES notation for 2-iodoacetamide;2-iodoacetohydrazide;stilbene?
The canonical SMILES for 2-iodoacetamide;2-iodoacetohydrazide;stilbene is C(=Cc1ccccc1)c1ccccc1.NC(=O)CI.NNC(=O)CI.
What is the InChIKey of 2-iodoacetamide;2-iodoacetohydrazide;stilbene?
The InChIKey is PQRACGLCMXXOSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12.C2H5IN2O.C2H4INO/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;3-1-2(6)5-4;3-1-2(4)5/h1-12H;1,4H2,(H,5,6);1H2,(H2,4,5).
What are the key properties of 2-iodoacetamide;2-iodoacetohydrazide;stilbene?
2-iodoacetamide;2-iodoacetohydrazide;stilbene has a molecular weight of 565.19 g/mol, XLogP of 3.17, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iodoacetamide;2-iodoacetohydrazide;stilbene is sourced from PubChem (CID 174899327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).