C19H19F3N2O3 — CID 174905438
tert-butyl 2-carbamoyl-3-methyl-4-pyridin-3-yl-5-(trifluoromethyl)benzoate (PubChem CID 174905438) has the molecular formula C19H19F3N2O3 and a molecular weight of 380.37 g/mol. Its IUPAC name is tert-butyl 2-carbamoyl-3-methyl-4-pyridin-3-yl-5-(trifluoromethyl)benzoate.
| Compound Name | tert-butyl 2-carbamoyl-3-methyl-4-pyridin-3-yl-5-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 174905438 |
| Molecular Formula | C19H19F3N2O3 |
| Molecular Weight | 380.37 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | tert-butyl 2-carbamoyl-3-methyl-4-pyridin-3-yl-5-(trifluoromethyl)benzoate |
| SMILES | Cc1c(C(N)=O)c(C(=O)OC(C)(C)C)cc(C(F)(F)F)c1-c1cccnc1 |
| InChI | InChI=1S/C19H19F3N2O3/c1-10-14(11-6-5-7-24-9-11)13(19(20,21)22)8-12(15(10)16(23)25)17(26)27-18(2,3)4/h5-9H,1-4H3,(H2,23,25) |
| InChIKey | CBGLCUHMEHAXEY-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.37 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |