C6H9N3O2 — CID 174907789
3-carbamoyl-1,1-bis(ethenyl)urea (PubChem CID 174907789) has the molecular formula C6H9N3O2 and a molecular weight of 155.16 g/mol. Its IUPAC name is 3-carbamoyl-1,1-bis(ethenyl)urea.
| Compound Name | 3-carbamoyl-1,1-bis(ethenyl)urea |
|---|---|
| PubChem CID | 174907789 |
| Molecular Formula | C6H9N3O2 |
| Molecular Weight | 155.16 g/mol |
| Exact Mass | 155.07 |
| IUPAC Name | 3-carbamoyl-1,1-bis(ethenyl)urea |
| SMILES | C=CN(C=C)C(=O)NC(N)=O |
| InChI | InChI=1S/C6H9N3O2/c1-3-9(4-2)6(11)8-5(7)10/h3-4H,1-2H2,(H3,7,8,10,11) |
| InChIKey | MGXBOVQRJGSJHT-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.16 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |