C4H5N3O2 — CID 91430503
1,5-dihydro-1,3,5-triazepine-2,4-dione (PubChem CID 91430503) has the molecular formula C4H5N3O2 and a molecular weight of 127.10 g/mol. Its IUPAC name is 1,5-dihydro-1,3,5-triazepine-2,4-dione.
| Compound Name | 1,5-dihydro-1,3,5-triazepine-2,4-dione |
|---|---|
| PubChem CID | 91430503 |
| Molecular Formula | C4H5N3O2 |
| Molecular Weight | 127.10 g/mol |
| Exact Mass | 127.04 |
| IUPAC Name | 1,5-dihydro-1,3,5-triazepine-2,4-dione |
| SMILES | O=C1NC=CNC(=O)N1 |
| InChI | InChI=1S/C4H5N3O2/c8-3-5-1-2-6-4(9)7-3/h1-2H,(H3,5,6,7,8,9) |
| InChIKey | ILBUXPKWOYTVNO-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.10 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |