About 5-nitrotetrazol-5-amine
5-nitrotetrazol-5-amine (PubChem CID 174910148) has the molecular formula CH2N6O2
and a molecular weight of 130.07 g/mol. Its IUPAC name is 5-nitrotetrazol-5-amine.
Molecular Properties
| Compound Name | 5-nitrotetrazol-5-amine |
| PubChem CID | 174910148 |
| Molecular Formula | CH2N6O2 |
| Molecular Weight | 130.07 g/mol |
| Exact Mass | 130.02 |
| IUPAC Name | 5-nitrotetrazol-5-amine |
| SMILES | NC1([N+](=O)[O-])N=NN=N1 |
| InChI | InChI=1S/CH2N6O2/c2-1(7(8)9)3-5-6-4-1/h2H2 |
| InChIKey | LRVQLPFROIWHHF-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 118.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.07 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-nitrotetrazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-nitrotetrazol-5-amine?
The IUPAC name of 5-nitrotetrazol-5-amine (CID 174910148) is 5-nitrotetrazol-5-amine.
What is the SMILES notation for 5-nitrotetrazol-5-amine?
The canonical SMILES for 5-nitrotetrazol-5-amine is NC1([N+](=O)[O-])N=NN=N1.
What is the InChIKey of 5-nitrotetrazol-5-amine?
The InChIKey is LRVQLPFROIWHHF-UHFFFAOYSA-N. The full InChI is InChI=1S/CH2N6O2/c2-1(7(8)9)3-5-6-4-1/h2H2.
What are the key properties of 5-nitrotetrazol-5-amine?
5-nitrotetrazol-5-amine has a molecular weight of 130.07 g/mol, XLogP of -0.33, 1 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-nitrotetrazol-5-amine is sourced from PubChem (CID 174910148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).