About cobalt;bis(5-nitrotetrazole-5-carboxylic acid)
cobalt;bis(5-nitrotetrazole-5-carboxylic acid) (PubChem CID 163204022) has the molecular formula C4H2CoN10O8
and a molecular weight of 377.06 g/mol. Its IUPAC name is cobalt;bis(5-nitrotetrazole-5-carboxylic acid).
Molecular Properties
| Compound Name | cobalt;bis(5-nitrotetrazole-5-carboxylic acid) |
| PubChem CID | 163204022 |
| Molecular Formula | C4H2CoN10O8 |
| Molecular Weight | 377.06 g/mol |
| Exact Mass | 376.94 |
| IUPAC Name | cobalt;bis(5-nitrotetrazole-5-carboxylic acid) |
| SMILES | O=C(O)C1([N+](=O)[O-])N=NN=N1.O=C(O)C1([N+](=O)[O-])N=NN=N1.[Co] |
| InChI | InChI=1S/2C2HN5O4.Co/c2*8-1(9)2(7(10)11)3-5-6-4-2;/h2*(H,8,9); |
| InChIKey | KSPHTCNMWGOCFU-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 259.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 377.06 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze cobalt;bis(5-nitrotetrazole-5-carboxylic acid) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt;bis(5-nitrotetrazole-5-carboxylic acid)?
The IUPAC name of cobalt;bis(5-nitrotetrazole-5-carboxylic acid) (CID 163204022) is cobalt;bis(5-nitrotetrazole-5-carboxylic acid).
What is the SMILES notation for cobalt;bis(5-nitrotetrazole-5-carboxylic acid)?
The canonical SMILES for cobalt;bis(5-nitrotetrazole-5-carboxylic acid) is O=C(O)C1([N+](=O)[O-])N=NN=N1.O=C(O)C1([N+](=O)[O-])N=NN=N1.[Co].
What is the InChIKey of cobalt;bis(5-nitrotetrazole-5-carboxylic acid)?
The InChIKey is KSPHTCNMWGOCFU-UHFFFAOYSA-N. The full InChI is InChI=1S/2C2HN5O4.Co/c2*8-1(9)2(7(10)11)3-5-6-4-2;/h2*(H,8,9);.
What are the key properties of cobalt;bis(5-nitrotetrazole-5-carboxylic acid)?
cobalt;bis(5-nitrotetrazole-5-carboxylic acid) has a molecular weight of 377.06 g/mol, XLogP of -0.33, 4 rotatable bonds, 2 hydrogen bond donors, and 14 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt;bis(5-nitrotetrazole-5-carboxylic acid) is sourced from PubChem (CID 163204022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).