C33H37N7O5 — CID 174912782
4-[[2-acetamido-5-(diaminomethylideneamino)pentanoyl]amino]-5-(1H-indol-3-yl)-3-oxo-2-(N-phenylanilino)pentanoic acid (PubChem CID 174912782) has the molecular formula C33H37N7O5 and a molecular weight of 611.70 g/mol. Its IUPAC name is 4-[[2-acetamido-5-(diaminomethylideneamino)pentanoyl]amino]-5-(1H-indol-3-yl)-3-oxo-2-(N-phenylanilino)pentanoic acid.
| Compound Name | 4-[[2-acetamido-5-(diaminomethylideneamino)pentanoyl]amino]-5-(1H-indol-3-yl)-3-oxo-2-(N-phenylanilino)pentanoic acid |
|---|---|
| PubChem CID | 174912782 |
| Molecular Formula | C33H37N7O5 |
| Molecular Weight | 611.70 g/mol |
| Exact Mass | 611.29 |
| IUPAC Name | 4-[[2-acetamido-5-(diaminomethylideneamino)pentanoyl]amino]-5-(1H-indol-3-yl)-3-oxo-2-(N-phenylanilino)pentanoic acid |
| SMILES | CC(=O)NC(CCCN=C(N)N)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)C(C(=O)O)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H37N7O5/c1-21(41)38-27(17-10-18-36-33(34)35)31(43)39-28(19-22-20-37-26-16-9-8-15-25(22)26)30(42)29(32(44)45)40(23-11-4-2-5-12-23)24-13-6-3-7-14-24/h2-9,11-16,20,27-29,37H,10,17-19H2,1H3,(H,38,41)(H,39,43)(H,44,45)(H4,34,35,36) |
| InChIKey | ICGUEGYLKWPHRH-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 196.00 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.70 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|