C24H33NO2 — CID 174915611
N,N-dibenzyl-1-cyclopentylethanamine;ethyl formate (PubChem CID 174915611) has the molecular formula C24H33NO2 and a molecular weight of 367.53 g/mol. Its IUPAC name is N,N-dibenzyl-1-cyclopentylethanamine;ethyl formate.
| Compound Name | N,N-dibenzyl-1-cyclopentylethanamine;ethyl formate |
|---|---|
| PubChem CID | 174915611 |
| Molecular Formula | C24H33NO2 |
| Molecular Weight | 367.53 g/mol |
| Exact Mass | 367.25 |
| IUPAC Name | N,N-dibenzyl-1-cyclopentylethanamine;ethyl formate |
| SMILES | CC(C1CCCC1)N(Cc1ccccc1)Cc1ccccc1.CCOC=O |
| InChI | InChI=1S/C21H27N.C3H6O2/c1-18(21-14-8-9-15-21)22(16-19-10-4-2-5-11-19)17-20-12-6-3-7-13-20;1-2-5-3-4/h2-7,10-13,18,21H,8-9,14-17H2,1H3;3H,2H2,1H3 |
| InChIKey | HDBVDMACRJTETE-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.53 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|