About 2-methylpropane-2-sulfonamide;S-prop-2-enylthiohydroxylamine
2-methylpropane-2-sulfonamide;S-prop-2-enylthiohydroxylamine (PubChem CID 174915958) has the molecular formula C7H18N2O2S2
and a molecular weight of 226.37 g/mol. Its IUPAC name is 2-methylpropane-2-sulfonamide;S-prop-2-enylthiohydroxylamine.
Molecular Properties
| Compound Name | 2-methylpropane-2-sulfonamide;S-prop-2-enylthiohydroxylamine |
| PubChem CID | 174915958 |
| Molecular Formula | C7H18N2O2S2 |
| Molecular Weight | 226.37 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 2-methylpropane-2-sulfonamide;S-prop-2-enylthiohydroxylamine |
| SMILES | C=CCSN.CC(C)(C)S(N)(=O)=O |
| InChI | InChI=1S/C4H11NO2S.C3H7NS/c1-4(2,3)8(5,6)7;1-2-3-5-4/h1-3H3,(H2,5,6,7);2H,1,3-4H2 |
| InChIKey | VCWSCEMZMBZAIT-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.37 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropane-2-sulfonamide;S-prop-2-enylthiohydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropane-2-sulfonamide;S-prop-2-enylthiohydroxylamine?
The IUPAC name of 2-methylpropane-2-sulfonamide;S-prop-2-enylthiohydroxylamine (CID 174915958) is 2-methylpropane-2-sulfonamide;S-prop-2-enylthiohydroxylamine.
What is the SMILES notation for 2-methylpropane-2-sulfonamide;S-prop-2-enylthiohydroxylamine?
The canonical SMILES for 2-methylpropane-2-sulfonamide;S-prop-2-enylthiohydroxylamine is C=CCSN.CC(C)(C)S(N)(=O)=O.
What is the InChIKey of 2-methylpropane-2-sulfonamide;S-prop-2-enylthiohydroxylamine?
The InChIKey is VCWSCEMZMBZAIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11NO2S.C3H7NS/c1-4(2,3)8(5,6)7;1-2-3-5-4/h1-3H3,(H2,5,6,7);2H,1,3-4H2.
What are the key properties of 2-methylpropane-2-sulfonamide;S-prop-2-enylthiohydroxylamine?
2-methylpropane-2-sulfonamide;S-prop-2-enylthiohydroxylamine has a molecular weight of 226.37 g/mol, XLogP of 0.85, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropane-2-sulfonamide;S-prop-2-enylthiohydroxylamine is sourced from PubChem (CID 174915958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).