C11H19N3O3 — CID 174916858
6-amino-2-(2-aminopent-3-ynoylamino)hexanoic acid (PubChem CID 174916858) has the molecular formula C11H19N3O3 and a molecular weight of 241.29 g/mol. Its IUPAC name is 6-amino-2-(2-aminopent-3-ynoylamino)hexanoic acid.
| Compound Name | 6-amino-2-(2-aminopent-3-ynoylamino)hexanoic acid |
|---|---|
| PubChem CID | 174916858 |
| Molecular Formula | C11H19N3O3 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | 6-amino-2-(2-aminopent-3-ynoylamino)hexanoic acid |
| SMILES | CC#CC(N)C(=O)NC(CCCCN)C(=O)O |
| InChI | InChI=1S/C11H19N3O3/c1-2-5-8(13)10(15)14-9(11(16)17)6-3-4-7-12/h8-9H,3-4,6-7,12-13H2,1H3,(H,14,15)(H,16,17) |
| InChIKey | TVOACFHOFKLPEF-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 118.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|