C23H20FN3O3S — CID 174918390
[4-[2-[3-(4-fluorophenyl)-7-methyl-1H-indole-2-carbonyl]hydrazinyl]phenyl]methanesulfinic acid (PubChem CID 174918390) has the molecular formula C23H20FN3O3S and a molecular weight of 437.50 g/mol. Its IUPAC name is [4-[2-[3-(4-fluorophenyl)-7-methyl-1H-indole-2-carbonyl]hydrazinyl]phenyl]methanesulfinic acid.
| Compound Name | [4-[2-[3-(4-fluorophenyl)-7-methyl-1H-indole-2-carbonyl]hydrazinyl]phenyl]methanesulfinic acid |
|---|---|
| PubChem CID | 174918390 |
| Molecular Formula | C23H20FN3O3S |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | [4-[2-[3-(4-fluorophenyl)-7-methyl-1H-indole-2-carbonyl]hydrazinyl]phenyl]methanesulfinic acid |
| SMILES | Cc1cccc2c(-c3ccc(F)cc3)c(C(=O)NNc3ccc(CS(=O)O)cc3)[nH]c12 |
| InChI | InChI=1S/C23H20FN3O3S/c1-14-3-2-4-19-20(16-7-9-17(24)10-8-16)22(25-21(14)19)23(28)27-26-18-11-5-15(6-12-18)13-31(29)30/h2-12,25-26H,13H2,1H3,(H,27,28)(H,29,30) |
| InChIKey | LUIZAIBSCRPEBP-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|